About cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride
cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride (PubChem CID 21094906) has the molecular formula C20H15F2HfP
and a molecular weight of 502.80 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride.
Molecular Properties
| Compound Name | cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride |
| PubChem CID | 21094906 |
| Molecular Formula | C20H15F2HfP |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride |
| SMILES | [C-]1=C(P(c2ccccc2)[c-]2ccc3ccccc32)C=CC1.[F-].[F-].[Hf+4] |
| InChI | InChI=1S/C20H15P.2FH.Hf/c1-2-9-17(10-3-1)21(18-11-5-6-12-18)20-15-14-16-8-4-7-13-19(16)20;;;/h1-5,7-11,13-15H,6H2;2*1H;/q-2;;;+4/p-2 |
| InChIKey | JAXLZACLIMTNFL-UHFFFAOYSA-L |
| XLogP | -1.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride?
The IUPAC name of cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride (CID 21094906) is cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride.
What is the SMILES notation for cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride?
The canonical SMILES for cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride is [C-]1=C(P(c2ccccc2)[c-]2ccc3ccccc32)C=CC1.[F-].[F-].[Hf+4].
What is the InChIKey of cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride?
The InChIKey is JAXLZACLIMTNFL-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H15P.2FH.Hf/c1-2-9-17(10-3-1)21(18-11-5-6-12-18)20-15-14-16-8-4-7-13-19(16)20;;;/h1-5,7-11,13-15H,6H2;2*1H;/q-2;;;+4/p-2.
What are the key properties of cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride?
cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride has a molecular weight of 502.80 g/mol, XLogP of -1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,4-dien-1-yl-inden-1-id-1-yl-phenylphosphane;hafnium(4+);difluoride is sourced from PubChem (CID 21094906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).