C20H22Cl2P2Ti — CID 21094935
2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl-[1H-inden-1-id-2-yl(methyl)phosphanyl]-methylphosphane;titanium(4+);dichloride (PubChem CID 21094935) has the molecular formula C20H22Cl2P2Ti and a molecular weight of 443.12 g/mol. Its IUPAC name is 2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl-[1H-inden-1-id-2-yl(methyl)phosphanyl]-methylphosphane;titanium(4+);dichloride.
| Compound Name | 2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl-[1H-inden-1-id-2-yl(methyl)phosphanyl]-methylphosphane;titanium(4+);dichloride |
|---|---|
| PubChem CID | 21094935 |
| Molecular Formula | C20H22Cl2P2Ti |
| Molecular Weight | 443.12 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl-[1H-inden-1-id-2-yl(methyl)phosphanyl]-methylphosphane;titanium(4+);dichloride |
| SMILES | CP(c1cc2ccccc2[cH-]1)P(C)C1[CH-]C2C=CC=CC2C1.[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C20H22P2.2ClH.Ti/c1-21(19-11-15-7-3-4-8-16(15)12-19)22(2)20-13-17-9-5-6-10-18(17)14-20;;;/h3-13,17-18,20H,14H2,1-2H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | KDWWMTRVKNGNSJ-UHFFFAOYSA-L |
| XLogP | -0.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.12 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|