About 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene
2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene (PubChem CID 21095227) has the molecular formula C25H22S2
and a molecular weight of 386.59 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene |
| PubChem CID | 21095227 |
| Molecular Formula | C25H22S2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene |
| SMILES | Cc1csc(-c2cc3c(cc2-c2scc(C)c2C)-c2ccccc2C3)c1C |
| InChI | InChI=1S/C25H22S2/c1-14-12-26-24(16(14)3)22-10-19-9-18-7-5-6-8-20(18)21(19)11-23(22)25-17(4)15(2)13-27-25/h5-8,10-13H,9H2,1-4H3 |
| InChIKey | UVORKFGASSCQMZ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene?
The IUPAC name of 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene (CID 21095227) is 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene.
What is the SMILES notation for 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene?
The canonical SMILES for 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene is Cc1csc(-c2cc3c(cc2-c2scc(C)c2C)-c2ccccc2C3)c1C.
What is the InChIKey of 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene?
The InChIKey is UVORKFGASSCQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22S2/c1-14-12-26-24(16(14)3)22-10-19-9-18-7-5-6-8-20(18)21(19)11-23(22)25-17(4)15(2)13-27-25/h5-8,10-13H,9H2,1-4H3.
What are the key properties of 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene?
2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene has a molecular weight of 386.59 g/mol, XLogP of 7.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethylthiophen-2-yl)-9H-fluoren-3-yl]-3,4-dimethylthiophene is sourced from PubChem (CID 21095227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).