C15H14F3N3O3 — CID 2109538
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2109538) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2109538 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H14F3N3O3/c16-8-3-4-9(12(18)11(8)17)19-10(22)7-21-13(23)15(20-14(21)24)5-1-2-6-15/h3-4H,1-2,5-7H2,(H,19,22)(H,20,24) |
| InChIKey | MGUMCROLSOBBPE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|