C17H20 — CID 21095473
1-ethyl-2-phenyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 21095473) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-ethyl-2-phenyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-ethyl-2-phenyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 21095473 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-ethyl-2-phenyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CCC1C(c2ccccc2)CC2C=CC=CC21 |
| InChI | InChI=1S/C17H20/c1-2-15-16-11-7-6-10-14(16)12-17(15)13-8-4-3-5-9-13/h3-11,14-17H,2,12H2,1H3 |
| InChIKey | WBEHZBGGTQFNDO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |