C19H29N — CID 21095822
3,4,5-tributylcyclopenta[c]pyrrole (PubChem CID 21095822) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 3,4,5-tributylcyclopenta[c]pyrrole.
| Compound Name | 3,4,5-tributylcyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 21095822 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 3,4,5-tributylcyclopenta[c]pyrrole |
| SMILES | CCCCC1=C(CCCC)C2=C(CCCC)N=CC2=C1 |
| InChI | InChI=1S/C19H29N/c1-4-7-10-15-13-16-14-20-18(12-9-6-3)19(16)17(15)11-8-5-2/h13-14H,4-12H2,1-3H3 |
| InChIKey | HLIGWRGESAEQTK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |