C34H48Cl2HfP2 — CID 21096353
di(butan-2-yl)-(1H-inden-1-id-2-yl)phosphane;hafnium(4+);1H-inden-1-id-2-yl-bis(2-methylpropyl)phosphane;dichloride (PubChem CID 21096353) has the molecular formula C34H48Cl2HfP2 and a molecular weight of 768.10 g/mol. Its IUPAC name is di(butan-2-yl)-(1H-inden-1-id-2-yl)phosphane;hafnium(4+);1H-inden-1-id-2-yl-bis(2-methylpropyl)phosphane;dichloride.
| Compound Name | di(butan-2-yl)-(1H-inden-1-id-2-yl)phosphane;hafnium(4+);1H-inden-1-id-2-yl-bis(2-methylpropyl)phosphane;dichloride |
|---|---|
| PubChem CID | 21096353 |
| Molecular Formula | C34H48Cl2HfP2 |
| Molecular Weight | 768.10 g/mol |
| Exact Mass | 768.21 |
| IUPAC Name | di(butan-2-yl)-(1H-inden-1-id-2-yl)phosphane;hafnium(4+);1H-inden-1-id-2-yl-bis(2-methylpropyl)phosphane;dichloride |
| SMILES | CC(C)CP(CC(C)C)c1cc2ccccc2[cH-]1.CCC(C)P(c1cc2ccccc2[cH-]1)C(C)CC.[Cl-].[Cl-].[Hf+4] |
| InChI | InChI=1S/2C17H24P.2ClH.Hf/c1-13(2)11-18(12-14(3)4)17-9-15-7-5-6-8-16(15)10-17;1-5-13(3)18(14(4)6-2)17-11-15-9-7-8-10-16(15)12-17;;;/h5-10,13-14H,11-12H2,1-4H3;7-14H,5-6H2,1-4H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | FPTWJNWRMJYIAC-UHFFFAOYSA-L |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.10 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|