About chloro(dimethoxy)arsane
chloro(dimethoxy)arsane (PubChem CID 21096828) has the molecular formula C2H6AsClO2
and a molecular weight of 172.44 g/mol. Its IUPAC name is chloro(dimethoxy)arsane.
Molecular Properties
| Compound Name | chloro(dimethoxy)arsane |
| PubChem CID | 21096828 |
| Molecular Formula | C2H6AsClO2 |
| Molecular Weight | 172.44 g/mol |
| Exact Mass | 171.93 |
| IUPAC Name | chloro(dimethoxy)arsane |
| SMILES | CO[As](Cl)OC |
| InChI | InChI=1S/C2H6AsClO2/c1-5-3(4)6-2/h1-2H3 |
| InChIKey | YALFUCFIBUXXLX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze chloro(dimethoxy)arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(dimethoxy)arsane?
The IUPAC name of chloro(dimethoxy)arsane (CID 21096828) is chloro(dimethoxy)arsane.
What is the SMILES notation for chloro(dimethoxy)arsane?
The canonical SMILES for chloro(dimethoxy)arsane is CO[As](Cl)OC.
What is the InChIKey of chloro(dimethoxy)arsane?
The InChIKey is YALFUCFIBUXXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6AsClO2/c1-5-3(4)6-2/h1-2H3.
What are the key properties of chloro(dimethoxy)arsane?
chloro(dimethoxy)arsane has a molecular weight of 172.44 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(dimethoxy)arsane is sourced from PubChem (CID 21096828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).