About CID 21096832
CID 21096832 (PubChem CID 21096832) has the molecular formula CHAsF2O
and a molecular weight of 141.94 g/mol.
Molecular Properties
| Compound Name | CID 21096832 |
| PubChem CID | 21096832 |
| Molecular Formula | CHAsF2O |
| Molecular Weight | 141.94 g/mol |
| Exact Mass | 141.92 |
| IUPAC Name | — |
| SMILES | FC(F)O[As] |
| InChI | InChI=1S/CHAsF2O/c2-5-1(3)4/h1H |
| InChIKey | KNJACHHKLHJPRN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.94 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21096832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21096832?
The IUPAC name of CID 21096832 (CID 21096832) is not available.
What is the SMILES notation for CID 21096832?
The canonical SMILES for CID 21096832 is FC(F)O[As].
What is the InChIKey of CID 21096832?
The InChIKey is KNJACHHKLHJPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/CHAsF2O/c2-5-1(3)4/h1H.
What are the key properties of CID 21096832?
CID 21096832 has a molecular weight of 141.94 g/mol, XLogP of 0.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21096832 is sourced from PubChem (CID 21096832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).