C4H3F5 — CID 21096869
(Z)-1,2,3,4,4-pentafluorobut-1-ene (PubChem CID 21096869) has the molecular formula C4H3F5 and a molecular weight of 146.06 g/mol. Its IUPAC name is (Z)-1,2,3,4,4-pentafluorobut-1-ene.
| Compound Name | (Z)-1,2,3,4,4-pentafluorobut-1-ene |
|---|---|
| PubChem CID | 21096869 |
| Molecular Formula | C4H3F5 |
| Molecular Weight | 146.06 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | (Z)-1,2,3,4,4-pentafluorobut-1-ene |
| SMILES | F/C=C(\F)C(F)C(F)F |
| InChI | InChI=1S/C4H3F5/c5-1-2(6)3(7)4(8)9/h1,3-4H/b2-1- |
| InChIKey | PPPRDNQESONMRT-UPHRSURJSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.06 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |