About 4-ethynylpyridin-2-amine
4-ethynylpyridin-2-amine (PubChem CID 21097262) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 4-ethynylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-ethynylpyridin-2-amine |
| PubChem CID | 21097262 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 4-ethynylpyridin-2-amine |
| SMILES | C#Cc1ccnc(N)c1 |
| InChI | InChI=1S/C7H6N2/c1-2-6-3-4-9-7(8)5-6/h1,3-5H,(H2,8,9) |
| InChIKey | IVHOXQCVRPYIDC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynylpyridin-2-amine?
The IUPAC name of 4-ethynylpyridin-2-amine (CID 21097262) is 4-ethynylpyridin-2-amine.
What is the SMILES notation for 4-ethynylpyridin-2-amine?
The canonical SMILES for 4-ethynylpyridin-2-amine is C#Cc1ccnc(N)c1.
What is the InChIKey of 4-ethynylpyridin-2-amine?
The InChIKey is IVHOXQCVRPYIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-6-3-4-9-7(8)5-6/h1,3-5H,(H2,8,9).
What are the key properties of 4-ethynylpyridin-2-amine?
4-ethynylpyridin-2-amine has a molecular weight of 118.14 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynylpyridin-2-amine is sourced from PubChem (CID 21097262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).