C16H30N2O2 — CID 21097549
(Z)-N',N',2,3-tetrapropylbut-2-enediamide (PubChem CID 21097549) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (Z)-N',N',2,3-tetrapropylbut-2-enediamide.
| Compound Name | (Z)-N',N',2,3-tetrapropylbut-2-enediamide |
|---|---|
| PubChem CID | 21097549 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (Z)-N',N',2,3-tetrapropylbut-2-enediamide |
| SMILES | CCC/C(C(N)=O)=C(\CCC)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C16H30N2O2/c1-5-9-13(15(17)19)14(10-6-2)16(20)18(11-7-3)12-8-4/h5-12H2,1-4H3,(H2,17,19)/b14-13- |
| InChIKey | VSMSEQHUFKCKLM-YPKPFQOOSA-N |
| XLogP | 3.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|