C24H25F9O3S3 — CID 21097619
1-(4-cyclohexylsulfanylnaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 21097619) has the molecular formula C24H25F9O3S3 and a molecular weight of 628.64 g/mol. Its IUPAC name is 1-(4-cyclohexylsulfanylnaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 1-(4-cyclohexylsulfanylnaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 21097619 |
| Molecular Formula | C24H25F9O3S3 |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 1-(4-cyclohexylsulfanylnaphthalen-1-yl)thiolan-1-ium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc2c([S+]3CCCC3)ccc(SC3CCCCC3)c2c1 |
| InChI | InChI=1S/C20H25S2.C4HF9O3S/c1-2-8-16(9-3-1)21-19-12-13-20(22-14-6-7-15-22)18-11-5-4-10-17(18)19;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-5,10-13,16H,1-3,6-9,14-15H2;(H,14,15,16)/q+1;/p-1 |
| InChIKey | KNVKRLIXCFSVGB-UHFFFAOYSA-M |
| XLogP | 7.99 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|