About CID 21097800
CID 21097800 (PubChem CID 21097800) has the molecular formula C14H6BF8
and a molecular weight of 337.00 g/mol.
Molecular Properties
| Compound Name | CID 21097800 |
| PubChem CID | 21097800 |
| Molecular Formula | C14H6BF8 |
| Molecular Weight | 337.00 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | — |
| SMILES | Cc1c(F)c(F)c(F)c([B]c2c(F)c(C)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C14H6BF8/c1-3-7(16)5(11(20)13(22)9(3)18)15-6-8(17)4(2)10(19)14(23)12(6)21/h1-2H3 |
| InChIKey | YAPRFIQEYVLQFU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.00 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21097800 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21097800?
The IUPAC name of CID 21097800 (CID 21097800) is not available.
What is the SMILES notation for CID 21097800?
The canonical SMILES for CID 21097800 is Cc1c(F)c(F)c(F)c([B]c2c(F)c(C)c(F)c(F)c2F)c1F.
What is the InChIKey of CID 21097800?
The InChIKey is YAPRFIQEYVLQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6BF8/c1-3-7(16)5(11(20)13(22)9(3)18)15-6-8(17)4(2)10(19)14(23)12(6)21/h1-2H3.
What are the key properties of CID 21097800?
CID 21097800 has a molecular weight of 337.00 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21097800 is sourced from PubChem (CID 21097800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).