About 11bH-indeno[2,1-c]isoquinoline-5,7-dione
11bH-indeno[2,1-c]isoquinoline-5,7-dione (PubChem CID 21097994) has the molecular formula C16H9NO2
and a molecular weight of 247.25 g/mol. Its IUPAC name is 11bH-indeno[2,1-c]isoquinoline-5,7-dione.
Molecular Properties
| Compound Name | 11bH-indeno[2,1-c]isoquinoline-5,7-dione |
| PubChem CID | 21097994 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 11bH-indeno[2,1-c]isoquinoline-5,7-dione |
| SMILES | O=C1N=C2C(=O)c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C16H9NO2/c18-15-11-7-3-1-5-9(11)13-10-6-2-4-8-12(10)16(19)17-14(13)15/h1-8,13H |
| InChIKey | DJKKALHEXOIKAV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11bH-indeno[2,1-c]isoquinoline-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11bH-indeno[2,1-c]isoquinoline-5,7-dione?
The IUPAC name of 11bH-indeno[2,1-c]isoquinoline-5,7-dione (CID 21097994) is 11bH-indeno[2,1-c]isoquinoline-5,7-dione.
What is the SMILES notation for 11bH-indeno[2,1-c]isoquinoline-5,7-dione?
The canonical SMILES for 11bH-indeno[2,1-c]isoquinoline-5,7-dione is O=C1N=C2C(=O)c3ccccc3C2c2ccccc21.
What is the InChIKey of 11bH-indeno[2,1-c]isoquinoline-5,7-dione?
The InChIKey is DJKKALHEXOIKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO2/c18-15-11-7-3-1-5-9(11)13-10-6-2-4-8-12(10)16(19)17-14(13)15/h1-8,13H.
What are the key properties of 11bH-indeno[2,1-c]isoquinoline-5,7-dione?
11bH-indeno[2,1-c]isoquinoline-5,7-dione has a molecular weight of 247.25 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11bH-indeno[2,1-c]isoquinoline-5,7-dione is sourced from PubChem (CID 21097994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).