About 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride
5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride (PubChem CID 21098311) has the molecular formula C8H14ClN3O
and a molecular weight of 203.67 g/mol. Its IUPAC name is 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride |
| PubChem CID | 21098311 |
| Molecular Formula | C8H14ClN3O |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride |
| SMILES | Cc1nc(C2CCNCC2)no1.Cl |
| InChI | InChI=1S/C8H13N3O.ClH/c1-6-10-8(11-12-6)7-2-4-9-5-3-7;/h7,9H,2-5H2,1H3;1H |
| InChIKey | ZPNGKRXVCMUARH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride?
The IUPAC name of 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride (CID 21098311) is 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride.
What is the SMILES notation for 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride?
The canonical SMILES for 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride is Cc1nc(C2CCNCC2)no1.Cl.
What is the InChIKey of 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride?
The InChIKey is ZPNGKRXVCMUARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O.ClH/c1-6-10-8(11-12-6)7-2-4-9-5-3-7;/h7,9H,2-5H2,1H3;1H.
What are the key properties of 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride?
5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride has a molecular weight of 203.67 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole;hydrochloride is sourced from PubChem (CID 21098311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).