C18H19ClN4 — CID 21098469
N-[1-[(2-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine (PubChem CID 21098469) has the molecular formula C18H19ClN4 and a molecular weight of 326.83 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 21098469 |
| Molecular Formula | C18H19ClN4 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-indazol-5-amine |
| SMILES | Clc1ccccc1CN1CCC(Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C18H19ClN4/c19-17-4-2-1-3-13(17)11-23-8-7-16(12-23)21-15-5-6-18-14(9-15)10-20-22-18/h1-6,9-10,16,21H,7-8,11-12H2,(H,20,22) |
| InChIKey | JQHQSWUFSHQDHF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |