C18H21FN2O3S2 — CID 21098720
(7Z)-N-[2-(4-fluorophenyl)ethyl]-7-hydroxyimino-N,6-dimethyl-5,6-dihydro-4H-1-benzothiophene-3-sulfonamide (PubChem CID 21098720) has the molecular formula C18H21FN2O3S2 and a molecular weight of 396.51 g/mol. Its IUPAC name is (7Z)-N-[2-(4-fluorophenyl)ethyl]-7-hydroxyimino-N,6-dimethyl-5,6-dihydro-4H-1-benzothiophene-3-sulfonamide.
| Compound Name | (7Z)-N-[2-(4-fluorophenyl)ethyl]-7-hydroxyimino-N,6-dimethyl-5,6-dihydro-4H-1-benzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 21098720 |
| Molecular Formula | C18H21FN2O3S2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (7Z)-N-[2-(4-fluorophenyl)ethyl]-7-hydroxyimino-N,6-dimethyl-5,6-dihydro-4H-1-benzothiophene-3-sulfonamide |
| SMILES | CC1CCc2c(S(=O)(=O)N(C)CCc3ccc(F)cc3)csc2/C1=N\O |
| InChI | InChI=1S/C18H21FN2O3S2/c1-12-3-8-15-16(11-25-18(15)17(12)20-22)26(23,24)21(2)10-9-13-4-6-14(19)7-5-13/h4-7,11-12,22H,3,8-10H2,1-2H3/b20-17- |
| InChIKey | AUSSDBWXHWPMSA-JZJYNLBNSA-N |
| XLogP | 3.51 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|