C17H18Cl3NO3 — CID 21099119
2-(1-butyl-5,6,8-trichloro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid (PubChem CID 21099119) has the molecular formula C17H18Cl3NO3 and a molecular weight of 390.69 g/mol. Its IUPAC name is 2-(1-butyl-5,6,8-trichloro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid.
| Compound Name | 2-(1-butyl-5,6,8-trichloro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid |
|---|---|
| PubChem CID | 21099119 |
| Molecular Formula | C17H18Cl3NO3 |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-(1-butyl-5,6,8-trichloro-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid |
| SMILES | CCCCC1(CC(=O)O)OCCc2c1[nH]c1c(Cl)cc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C17H18Cl3NO3/c1-2-3-5-17(8-12(22)23)16-9(4-6-24-17)13-14(20)10(18)7-11(19)15(13)21-16/h7,21H,2-6,8H2,1H3,(H,22,23) |
| InChIKey | AVKZUJNKMCAOSQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|