About 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol
2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol (PubChem CID 21099385) has the molecular formula C19H15F2NO3S
and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol |
| PubChem CID | 21099385 |
| Molecular Formula | C19H15F2NO3S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(CC(O)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C19H15F2NO3S/c20-13-6-9-17(18(21)10-13)19(23)11-14-7-8-16(12-22-14)26(24,25)15-4-2-1-3-5-15/h1-10,12,19,23H,11H2 |
| InChIKey | KZBJDOCSMRQNKZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol?
The IUPAC name of 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol (CID 21099385) is 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol.
What is the SMILES notation for 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol?
The canonical SMILES for 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol is O=S(=O)(c1ccccc1)c1ccc(CC(O)c2ccc(F)cc2F)nc1.
What is the InChIKey of 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol?
The InChIKey is KZBJDOCSMRQNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2NO3S/c20-13-6-9-17(18(21)10-13)19(23)11-14-7-8-16(12-22-14)26(24,25)15-4-2-1-3-5-15/h1-10,12,19,23H,11H2.
What are the key properties of 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol?
2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol has a molecular weight of 375.40 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(benzenesulfonyl)-2-pyridinyl]-1-(2,4-difluorophenyl)ethanol is sourced from PubChem (CID 21099385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).