C21H13F2NO3S — CID 21099418
2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]phenyl]sulfonylbenzonitrile (PubChem CID 21099418) has the molecular formula C21H13F2NO3S and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]phenyl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]phenyl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 21099418 |
| Molecular Formula | C21H13F2NO3S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]phenyl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)c1ccc(CC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C21H13F2NO3S/c22-16-7-10-18(19(23)12-16)20(25)11-14-5-8-17(9-6-14)28(26,27)21-4-2-1-3-15(21)13-24/h1-10,12H,11H2 |
| InChIKey | VWJYRLWUTJUQHU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |