C24H24F2N2O3S — CID 21099461
3-[2-[[6-[(E)-2-(2,4-difluorophenyl)ethenyl]-3-pyridinyl]sulfonyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 21099461) has the molecular formula C24H24F2N2O3S and a molecular weight of 458.53 g/mol. Its IUPAC name is 3-[2-[[6-[(E)-2-(2,4-difluorophenyl)ethenyl]-3-pyridinyl]sulfonyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-[[6-[(E)-2-(2,4-difluorophenyl)ethenyl]-3-pyridinyl]sulfonyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 21099461 |
| Molecular Formula | C24H24F2N2O3S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[2-[[6-[(E)-2-(2,4-difluorophenyl)ethenyl]-3-pyridinyl]sulfonyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccccc1S(=O)(=O)c1ccc(/C=C/c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C24H24F2N2O3S/c1-28(2)14-5-15-31-23-6-3-4-7-24(23)32(29,30)21-13-12-20(27-17-21)11-9-18-8-10-19(25)16-22(18)26/h3-4,6-13,16-17H,5,14-15H2,1-2H3/b11-9+ |
| InChIKey | RKWWKTHOHZWNMX-PKNBQFBNSA-N |
| XLogP | 4.69 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|