About 2-(2-methylpropyl)-1,2-benzothiazol-3-one
2-(2-methylpropyl)-1,2-benzothiazol-3-one (PubChem CID 21099553) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-1,2-benzothiazol-3-one |
| PubChem CID | 21099553 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-(2-methylpropyl)-1,2-benzothiazol-3-one |
| SMILES | CC(C)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C11H13NOS/c1-8(2)7-12-11(13)9-5-3-4-6-10(9)14-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | JZMXCENGODLQED-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methylpropyl)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-1,2-benzothiazol-3-one?
The IUPAC name of 2-(2-methylpropyl)-1,2-benzothiazol-3-one (CID 21099553) is 2-(2-methylpropyl)-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-(2-methylpropyl)-1,2-benzothiazol-3-one?
The canonical SMILES for 2-(2-methylpropyl)-1,2-benzothiazol-3-one is CC(C)Cn1sc2ccccc2c1=O.
What is the InChIKey of 2-(2-methylpropyl)-1,2-benzothiazol-3-one?
The InChIKey is JZMXCENGODLQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-8(2)7-12-11(13)9-5-3-4-6-10(9)14-12/h3-6,8H,7H2,1-2H3.
What are the key properties of 2-(2-methylpropyl)-1,2-benzothiazol-3-one?
2-(2-methylpropyl)-1,2-benzothiazol-3-one has a molecular weight of 207.30 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-1,2-benzothiazol-3-one is sourced from PubChem (CID 21099553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).