C33H39N3O9SSi — CID 21099591
[(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate (PubChem CID 21099591) has the molecular formula C33H39N3O9SSi and a molecular weight of 681.84 g/mol. Its IUPAC name is [(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 21099591 |
| Molecular Formula | C33H39N3O9SSi |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.22 |
| IUPAC Name | [(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(COS(=O)(=O)c2ccc(C)cc2)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H39N3O9SSi/c1-23-17-19-26(20-18-23)46(39,40)41-21-33(30(35-36-34)29(43-24(2)37)31(45-33)44-25(3)38)22-42-47(32(4,5)6,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h7-20,29-31H,21-22H2,1-6H3/t29-,30+,31?,33-/m1/s1 |
| InChIKey | USBBBRWXSLGINW-BNKKYZKKSA-N |
| XLogP | 4.55 |
| TPSA | 163.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|