About 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane
7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane (PubChem CID 21099648) has the molecular formula C13H16OSi
and a molecular weight of 216.36 g/mol. Its IUPAC name is 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane.
Molecular Properties
| Compound Name | 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane |
| PubChem CID | 21099648 |
| Molecular Formula | C13H16OSi |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane |
| SMILES | C=C[Si](C=C)(C=C)OC1C2C=CC1C=C2 |
| InChI | InChI=1S/C13H16OSi/c1-4-15(5-2,6-3)14-13-11-7-8-12(13)10-9-11/h4-13H,1-3H2 |
| InChIKey | PSFCZPVIWVVHOT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane?
The IUPAC name of 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane (CID 21099648) is 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane.
What is the SMILES notation for 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane?
The canonical SMILES for 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane is C=C[Si](C=C)(C=C)OC1C2C=CC1C=C2.
What is the InChIKey of 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane?
The InChIKey is PSFCZPVIWVVHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16OSi/c1-4-15(5-2,6-3)14-13-11-7-8-12(13)10-9-11/h4-13H,1-3H2.
What are the key properties of 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane?
7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane has a molecular weight of 216.36 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bicyclo[2.2.1]hepta-2,5-dienyloxy-tris(ethenyl)silane is sourced from PubChem (CID 21099648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).