About butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate
butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate (PubChem CID 21099825) has the molecular formula C11H16N2O5
and a molecular weight of 256.26 g/mol. Its IUPAC name is butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate.
Molecular Properties
| Compound Name | butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate |
| PubChem CID | 21099825 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate |
| SMILES | CCCC=O.CCOC(=O)NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O4.C4H8O/c1-2-13-7(12)8-9-5(10)3-4-6(9)11;1-2-3-4-5/h3-4H,2H2,1H3,(H,8,12);4H,2-3H2,1H3 |
| InChIKey | FLDYAUDTQHTPOV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate?
The IUPAC name of butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate (CID 21099825) is butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate.
What is the SMILES notation for butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate?
The canonical SMILES for butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate is CCCC=O.CCOC(=O)NN1C(=O)C=CC1=O.
What is the InChIKey of butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate?
The InChIKey is FLDYAUDTQHTPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4.C4H8O/c1-2-13-7(12)8-9-5(10)3-4-6(9)11;1-2-3-4-5/h3-4H,2H2,1H3,(H,8,12);4H,2-3H2,1H3.
What are the key properties of butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate?
butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate has a molecular weight of 256.26 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanal;ethyl N-(2,5-dioxopyrrol-1-yl)carbamate is sourced from PubChem (CID 21099825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).