About Metanephrine
Metanephrine (PubChem CID 21100) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenol.
Molecular Properties
| Compound Name | Metanephrine |
| PubChem CID | 21100 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenol |
| SMILES | CNCC(C1=CC(=C(C=C1)O)OC)O |
| InChI | InChI=1S/C10H15NO3/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2/h3-5,9,11-13H,6H2,1-2H3 |
| InChIKey | JWJCTZKFYGDABJ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 165 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Metanephrine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Metanephrine?
The IUPAC name of Metanephrine (CID 21100) is 4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenol.
What is the SMILES notation for Metanephrine?
The canonical SMILES for Metanephrine is CNCC(C1=CC(=C(C=C1)O)OC)O.
What is the InChIKey of Metanephrine?
The InChIKey is JWJCTZKFYGDABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2/h3-5,9,11-13H,6H2,1-2H3.
What are the key properties of Metanephrine?
Metanephrine has a molecular weight of 197.23 g/mol, XLogP of -1.00, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Metanephrine is sourced from PubChem (CID 21100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).