About 2-iodo-4,5-dimethyl-1,3-thiazole
2-iodo-4,5-dimethyl-1,3-thiazole (PubChem CID 21100233) has the molecular formula C5H6INS
and a molecular weight of 239.08 g/mol. Its IUPAC name is 2-iodo-4,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-iodo-4,5-dimethyl-1,3-thiazole |
| PubChem CID | 21100233 |
| Molecular Formula | C5H6INS |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 238.93 |
| IUPAC Name | 2-iodo-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(I)sc1C |
| InChI | InChI=1S/C5H6INS/c1-3-4(2)8-5(6)7-3/h1-2H3 |
| InChIKey | CJROBJQQMDDHLX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-4,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-4,5-dimethyl-1,3-thiazole?
The IUPAC name of 2-iodo-4,5-dimethyl-1,3-thiazole (CID 21100233) is 2-iodo-4,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 2-iodo-4,5-dimethyl-1,3-thiazole?
The canonical SMILES for 2-iodo-4,5-dimethyl-1,3-thiazole is Cc1nc(I)sc1C.
What is the InChIKey of 2-iodo-4,5-dimethyl-1,3-thiazole?
The InChIKey is CJROBJQQMDDHLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6INS/c1-3-4(2)8-5(6)7-3/h1-2H3.
What are the key properties of 2-iodo-4,5-dimethyl-1,3-thiazole?
2-iodo-4,5-dimethyl-1,3-thiazole has a molecular weight of 239.08 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-4,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 21100233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).