About N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine
N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine (PubChem CID 21100438) has the molecular formula C23H27ClN4
and a molecular weight of 394.95 g/mol. Its IUPAC name is N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine.
Molecular Properties
| Compound Name | N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine |
| PubChem CID | 21100438 |
| Molecular Formula | C23H27ClN4 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine |
| SMILES | Cc1cccc2c(NCCCCCCN)nc(/C=C/c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C23H27ClN4/c1-17-7-6-8-20-22(17)27-21(14-11-18-9-12-19(24)13-10-18)28-23(20)26-16-5-3-2-4-15-25/h6-14H,2-5,15-16,25H2,1H3,(H,26,27,28)/b14-11+ |
| InChIKey | WODJVYANAZCAAS-SDNWHVSQSA-N |
| XLogP | 5.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine?
The IUPAC name of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine (CID 21100438) is N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine.
What is the SMILES notation for N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine?
The canonical SMILES for N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine is Cc1cccc2c(NCCCCCCN)nc(/C=C/c3ccc(Cl)cc3)nc12.
What is the InChIKey of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine?
The InChIKey is WODJVYANAZCAAS-SDNWHVSQSA-N. The full InChI is InChI=1S/C23H27ClN4/c1-17-7-6-8-20-22(17)27-21(14-11-18-9-12-19(24)13-10-18)28-23(20)26-16-5-3-2-4-15-25/h6-14H,2-5,15-16,25H2,1H3,(H,26,27,28)/b14-11+.
What are the key properties of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine?
N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine has a molecular weight of 394.95 g/mol, XLogP of 5.69, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]-8-methylquinazolin-4-yl]hexane-1,6-diamine is sourced from PubChem (CID 21100438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).