C26H25N3O2 — CID 21100474
2,6,7-trimethyl-4-phenoxy-1-[2-(3-phenylprop-2-ynoxy)ethyl]imidazo[4,5-c]pyridine (PubChem CID 21100474) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2,6,7-trimethyl-4-phenoxy-1-[2-(3-phenylprop-2-ynoxy)ethyl]imidazo[4,5-c]pyridine.
| Compound Name | 2,6,7-trimethyl-4-phenoxy-1-[2-(3-phenylprop-2-ynoxy)ethyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 21100474 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2,6,7-trimethyl-4-phenoxy-1-[2-(3-phenylprop-2-ynoxy)ethyl]imidazo[4,5-c]pyridine |
| SMILES | Cc1nc(Oc2ccccc2)c2nc(C)n(CCOCC#Cc3ccccc3)c2c1C |
| InChI | InChI=1S/C26H25N3O2/c1-19-20(2)27-26(31-23-14-8-5-9-15-23)24-25(19)29(21(3)28-24)16-18-30-17-10-13-22-11-6-4-7-12-22/h4-9,11-12,14-15H,16-18H2,1-3H3 |
| InChIKey | CIQUGPDNILBKNU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|