C27H25Cl3FN5O — CID 21100917
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide (PubChem CID 21100917) has the molecular formula C27H25Cl3FN5O and a molecular weight of 560.89 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 21100917 |
| Molecular Formula | C27H25Cl3FN5O |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide |
| SMILES | O=C(NCCCN1CCN(c2cccc(Cl)c2)CC1)c1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C27H25Cl3FN5O/c28-18-3-1-4-19(14-18)36-11-9-35(10-12-36)8-2-7-32-27(37)17-5-6-20(23(31)13-17)26-33-24-15-21(29)22(30)16-25(24)34-26/h1,3-6,13-16H,2,7-12H2,(H,32,37)(H,33,34) |
| InChIKey | OFPRHWNZKLPEJG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|