C22H27ClF3N5O3 — CID 21101825
tert-butyl 4-[7-chloro-2-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]quinolin-4-yl]piperazine-1-carboxylate (PubChem CID 21101825) has the molecular formula C22H27ClF3N5O3 and a molecular weight of 501.94 g/mol. Its IUPAC name is tert-butyl 4-[7-chloro-2-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]quinolin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-chloro-2-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]quinolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21101825 |
| Molecular Formula | C22H27ClF3N5O3 |
| Molecular Weight | 501.94 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | tert-butyl 4-[7-chloro-2-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]quinolin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(NC(=O)C(F)(F)F)Nc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C22H27ClF3N5O3/c1-13(28-19(32)22(24,25)26)27-18-12-17(15-6-5-14(23)11-16(15)29-18)30-7-9-31(10-8-30)20(33)34-21(2,3)4/h5-6,11-13H,7-10H2,1-4H3,(H,27,29)(H,28,32) |
| InChIKey | OECLKIFMRPQOOK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.94 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|