C23H33N5O2 — CID 21102084
7-ethyl-5-[3-oxo-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-2H-indazole-3-carboxamide (PubChem CID 21102084) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 7-ethyl-5-[3-oxo-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-2H-indazole-3-carboxamide.
| Compound Name | 7-ethyl-5-[3-oxo-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-2H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 21102084 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 7-ethyl-5-[3-oxo-3-(4-piperidin-1-ylpiperidin-1-yl)propyl]-2H-indazole-3-carboxamide |
| SMILES | CCc1cc(CCC(=O)N2CCC(N3CCCCC3)CC2)cc2c(C(N)=O)[nH]nc12 |
| InChI | InChI=1S/C23H33N5O2/c1-2-17-14-16(15-19-21(17)25-26-22(19)23(24)30)6-7-20(29)28-12-8-18(9-13-28)27-10-4-3-5-11-27/h14-15,18H,2-13H2,1H3,(H2,24,30)(H,25,26) |
| InChIKey | SJRBRLVHBFDMRC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |