C15H9F15O9S3 — CID 21102714
[3,4-bis(2,2,3,3,3-pentafluoropropylsulfonyloxy)phenyl] 2,2,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 21102714) has the molecular formula C15H9F15O9S3 and a molecular weight of 714.40 g/mol. Its IUPAC name is [3,4-bis(2,2,3,3,3-pentafluoropropylsulfonyloxy)phenyl] 2,2,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | [3,4-bis(2,2,3,3,3-pentafluoropropylsulfonyloxy)phenyl] 2,2,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 21102714 |
| Molecular Formula | C15H9F15O9S3 |
| Molecular Weight | 714.40 g/mol |
| Exact Mass | 713.92 |
| IUPAC Name | [3,4-bis(2,2,3,3,3-pentafluoropropylsulfonyloxy)phenyl] 2,2,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | O=S(=O)(CC(F)(F)C(F)(F)F)Oc1ccc(OS(=O)(=O)CC(F)(F)C(F)(F)F)c(OS(=O)(=O)CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F15O9S3/c16-10(17,13(22,23)24)4-40(31,32)37-7-1-2-8(38-41(33,34)5-11(18,19)14(25,26)27)9(3-7)39-42(35,36)6-12(20,21)15(28,29)30/h1-3H,4-6H2 |
| InChIKey | CSBJOWRIQIASLO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|