C24H15F27O9S3 — CID 21102716
[3,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)phenyl] 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate (PubChem CID 21102716) has the molecular formula C24H15F27O9S3 and a molecular weight of 1056.52 g/mol. Its IUPAC name is [3,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)phenyl] 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate.
| Compound Name | [3,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)phenyl] 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 21102716 |
| Molecular Formula | C24H15F27O9S3 |
| Molecular Weight | 1056.52 g/mol |
| Exact Mass | 1055.94 |
| IUPAC Name | [3,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonyloxy)phenyl] 3,3,4,4,5,5,6,6,6-nonafluorohexane-1-sulfonate |
| SMILES | O=S(=O)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Oc1ccc(OS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(OS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H15F27O9S3/c25-13(26,16(31,32)19(37,38)22(43,44)45)3-6-61(52,53)58-10-1-2-11(59-62(54,55)7-4-14(27,28)17(33,34)20(39,40)23(46,47)48)12(9-10)60-63(56,57)8-5-15(29,30)18(35,36)21(41,42)24(49,50)51/h1-2,9H,3-8H2 |
| InChIKey | VNHPJSYPAKWJJC-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.52 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|