C8H12F6O6S2 — CID 21102771
3-(2,2,2-trifluoroethylsulfonyloxy)butyl 2,2,2-trifluoroethanesulfonate (PubChem CID 21102771) has the molecular formula C8H12F6O6S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfonyloxy)butyl 2,2,2-trifluoroethanesulfonate.
| Compound Name | 3-(2,2,2-trifluoroethylsulfonyloxy)butyl 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 21102771 |
| Molecular Formula | C8H12F6O6S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfonyloxy)butyl 2,2,2-trifluoroethanesulfonate |
| SMILES | CC(CCOS(=O)(=O)CC(F)(F)F)OS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H12F6O6S2/c1-6(20-22(17,18)5-8(12,13)14)2-3-19-21(15,16)4-7(9,10)11/h6H,2-5H2,1H3 |
| InChIKey | LGGXFJBZDMUCSS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|