C10H8F6O6S2 — CID 21102791
[4-(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate (PubChem CID 21102791) has the molecular formula C10H8F6O6S2 and a molecular weight of 402.29 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate.
| Compound Name | [4-(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 21102791 |
| Molecular Formula | C10H8F6O6S2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | [4-(2,2,2-trifluoroethylsulfonyloxy)phenyl] 2,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)(CC(F)(F)F)Oc1ccc(OS(=O)(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F6O6S2/c11-9(12,13)5-23(17,18)21-7-1-2-8(4-3-7)22-24(19,20)6-10(14,15)16/h1-4H,5-6H2 |
| InChIKey | YIOJTAGVCLJNCD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|