About 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate
1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate (PubChem CID 21102816) has the molecular formula C13H22O3SSi
and a molecular weight of 286.47 g/mol. Its IUPAC name is 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate.
Molecular Properties
| Compound Name | 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate |
| PubChem CID | 21102816 |
| Molecular Formula | C13H22O3SSi |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate |
| SMILES | Cc1cc(C)cc(S(=O)(=O)OC(C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C13H22O3SSi/c1-10-7-11(2)9-13(8-10)17(14,15)16-12(3)18(4,5)6/h7-9,12H,1-6H3 |
| InChIKey | VGVFMLZMTGMKPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate?
The IUPAC name of 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate (CID 21102816) is 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate.
What is the SMILES notation for 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate?
The canonical SMILES for 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate is Cc1cc(C)cc(S(=O)(=O)OC(C)[Si](C)(C)C)c1.
What is the InChIKey of 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate?
The InChIKey is VGVFMLZMTGMKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3SSi/c1-10-7-11(2)9-13(8-10)17(14,15)16-12(3)18(4,5)6/h7-9,12H,1-6H3.
What are the key properties of 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate?
1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate has a molecular weight of 286.47 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethylsilylethyl 3,5-dimethylbenzenesulfonate is sourced from PubChem (CID 21102816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).