About [dimethyl(propan-2-yl)silyl] ethanesulfonate
[dimethyl(propan-2-yl)silyl] ethanesulfonate (PubChem CID 21102887) has the molecular formula C7H18O3SSi
and a molecular weight of 210.37 g/mol. Its IUPAC name is [dimethyl(propan-2-yl)silyl] ethanesulfonate.
Molecular Properties
| Compound Name | [dimethyl(propan-2-yl)silyl] ethanesulfonate |
| PubChem CID | 21102887 |
| Molecular Formula | C7H18O3SSi |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | [dimethyl(propan-2-yl)silyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)O[Si](C)(C)C(C)C |
| InChI | InChI=1S/C7H18O3SSi/c1-6-11(8,9)10-12(4,5)7(2)3/h7H,6H2,1-5H3 |
| InChIKey | FJOUGFOSILOSGJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(propan-2-yl)silyl] ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(propan-2-yl)silyl] ethanesulfonate?
The IUPAC name of [dimethyl(propan-2-yl)silyl] ethanesulfonate (CID 21102887) is [dimethyl(propan-2-yl)silyl] ethanesulfonate.
What is the SMILES notation for [dimethyl(propan-2-yl)silyl] ethanesulfonate?
The canonical SMILES for [dimethyl(propan-2-yl)silyl] ethanesulfonate is CCS(=O)(=O)O[Si](C)(C)C(C)C.
What is the InChIKey of [dimethyl(propan-2-yl)silyl] ethanesulfonate?
The InChIKey is FJOUGFOSILOSGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3SSi/c1-6-11(8,9)10-12(4,5)7(2)3/h7H,6H2,1-5H3.
What are the key properties of [dimethyl(propan-2-yl)silyl] ethanesulfonate?
[dimethyl(propan-2-yl)silyl] ethanesulfonate has a molecular weight of 210.37 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(propan-2-yl)silyl] ethanesulfonate is sourced from PubChem (CID 21102887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).