About [ethyl(dimethyl)silyl] propane-1-sulfonate
[ethyl(dimethyl)silyl] propane-1-sulfonate (PubChem CID 21102941) has the molecular formula C7H18O3SSi
and a molecular weight of 210.37 g/mol. Its IUPAC name is [ethyl(dimethyl)silyl] propane-1-sulfonate.
Molecular Properties
| Compound Name | [ethyl(dimethyl)silyl] propane-1-sulfonate |
| PubChem CID | 21102941 |
| Molecular Formula | C7H18O3SSi |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | [ethyl(dimethyl)silyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O[Si](C)(C)CC |
| InChI | InChI=1S/C7H18O3SSi/c1-5-7-11(8,9)10-12(3,4)6-2/h5-7H2,1-4H3 |
| InChIKey | DNMVMDVMFUAORB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethyl(dimethyl)silyl] propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethyl(dimethyl)silyl] propane-1-sulfonate?
The IUPAC name of [ethyl(dimethyl)silyl] propane-1-sulfonate (CID 21102941) is [ethyl(dimethyl)silyl] propane-1-sulfonate.
What is the SMILES notation for [ethyl(dimethyl)silyl] propane-1-sulfonate?
The canonical SMILES for [ethyl(dimethyl)silyl] propane-1-sulfonate is CCCS(=O)(=O)O[Si](C)(C)CC.
What is the InChIKey of [ethyl(dimethyl)silyl] propane-1-sulfonate?
The InChIKey is DNMVMDVMFUAORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3SSi/c1-5-7-11(8,9)10-12(3,4)6-2/h5-7H2,1-4H3.
What are the key properties of [ethyl(dimethyl)silyl] propane-1-sulfonate?
[ethyl(dimethyl)silyl] propane-1-sulfonate has a molecular weight of 210.37 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl(dimethyl)silyl] propane-1-sulfonate is sourced from PubChem (CID 21102941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).