C15H17F15O9S3 — CID 21103028
2,2-bis(2,2,3,3,3-pentafluoropropylsulfonyloxymethyl)butyl 2,2,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 21103028) has the molecular formula C15H17F15O9S3 and a molecular weight of 722.46 g/mol. Its IUPAC name is 2,2-bis(2,2,3,3,3-pentafluoropropylsulfonyloxymethyl)butyl 2,2,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | 2,2-bis(2,2,3,3,3-pentafluoropropylsulfonyloxymethyl)butyl 2,2,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 21103028 |
| Molecular Formula | C15H17F15O9S3 |
| Molecular Weight | 722.46 g/mol |
| Exact Mass | 721.98 |
| IUPAC Name | 2,2-bis(2,2,3,3,3-pentafluoropropylsulfonyloxymethyl)butyl 2,2,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | CCC(COS(=O)(=O)CC(F)(F)C(F)(F)F)(COS(=O)(=O)CC(F)(F)C(F)(F)F)COS(=O)(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F15O9S3/c1-2-9(3-37-40(31,32)6-10(16,17)13(22,23)24,4-38-41(33,34)7-11(18,19)14(25,26)27)5-39-42(35,36)8-12(20,21)15(28,29)30/h2-8H2,1H3 |
| InChIKey | NWEFLUNMZRCFRG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|