About 6-acetamidohexanamide
6-acetamidohexanamide (PubChem CID 21103226) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 6-acetamidohexanamide.
Molecular Properties
| Compound Name | 6-acetamidohexanamide |
| PubChem CID | 21103226 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 6-acetamidohexanamide |
| SMILES | CC(=O)NCCCCCC(N)=O |
| InChI | InChI=1S/C8H16N2O2/c1-7(11)10-6-4-2-3-5-8(9)12/h2-6H2,1H3,(H2,9,12)(H,10,11) |
| InChIKey | DKTLRYBPEORJBF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-acetamidohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetamidohexanamide?
The IUPAC name of 6-acetamidohexanamide (CID 21103226) is 6-acetamidohexanamide.
What is the SMILES notation for 6-acetamidohexanamide?
The canonical SMILES for 6-acetamidohexanamide is CC(=O)NCCCCCC(N)=O.
What is the InChIKey of 6-acetamidohexanamide?
The InChIKey is DKTLRYBPEORJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-7(11)10-6-4-2-3-5-8(9)12/h2-6H2,1H3,(H2,9,12)(H,10,11).
What are the key properties of 6-acetamidohexanamide?
6-acetamidohexanamide has a molecular weight of 172.23 g/mol, XLogP of 0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetamidohexanamide is sourced from PubChem (CID 21103226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).