C7H8F3N7O — CID 21103635
1-[(2S,4S)-4-azido-2-(azidomethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 21103635) has the molecular formula C7H8F3N7O and a molecular weight of 263.18 g/mol. Its IUPAC name is 1-[(2S,4S)-4-azido-2-(azidomethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2S,4S)-4-azido-2-(azidomethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 21103635 |
| Molecular Formula | C7H8F3N7O |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-[(2S,4S)-4-azido-2-(azidomethyl)pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | [N-]=[N+]=NC[C@@H]1C[C@H](N=[N+]=[N-])CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N7O/c8-7(9,10)6(18)17-3-4(14-16-12)1-5(17)2-13-15-11/h4-5H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | FQBBUHMJMBSKOL-WHFBIAKZSA-N |
| XLogP | 2.14 |
| TPSA | 117.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|