About 1,2-benzodioxine-3,4-dione
1,2-benzodioxine-3,4-dione (PubChem CID 21103826) has the molecular formula C8H4O4
and a molecular weight of 164.12 g/mol. Its IUPAC name is 1,2-benzodioxine-3,4-dione.
Molecular Properties
| Compound Name | 1,2-benzodioxine-3,4-dione |
| PubChem CID | 21103826 |
| Molecular Formula | C8H4O4 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | 1,2-benzodioxine-3,4-dione |
| SMILES | O=c1ooc2ccccc2c1=O |
| InChI | InChI=1S/C8H4O4/c9-7-5-3-1-2-4-6(5)11-12-8(7)10/h1-4H |
| InChIKey | PELFZSLCMUAKRZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-benzodioxine-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzodioxine-3,4-dione?
The IUPAC name of 1,2-benzodioxine-3,4-dione (CID 21103826) is 1,2-benzodioxine-3,4-dione.
What is the SMILES notation for 1,2-benzodioxine-3,4-dione?
The canonical SMILES for 1,2-benzodioxine-3,4-dione is O=c1ooc2ccccc2c1=O.
What is the InChIKey of 1,2-benzodioxine-3,4-dione?
The InChIKey is PELFZSLCMUAKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O4/c9-7-5-3-1-2-4-6(5)11-12-8(7)10/h1-4H.
What are the key properties of 1,2-benzodioxine-3,4-dione?
1,2-benzodioxine-3,4-dione has a molecular weight of 164.12 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzodioxine-3,4-dione is sourced from PubChem (CID 21103826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).