C20H33N11 — CID 21104147
1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(3-methylphenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21104147) has the molecular formula C20H33N11 and a molecular weight of 427.56 g/mol. Its IUPAC name is 1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(3-methylphenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(3-methylphenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21104147 |
| Molecular Formula | C20H33N11 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-[2-(3-methylphenyl)hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | Cc1cccc(NNc2nc(N3CC(N)CC(N)C3)nc(N3CC(N)CC(N)C3)n2)c1 |
| InChI | InChI=1S/C20H33N11/c1-12-3-2-4-17(5-12)28-29-18-25-19(30-8-13(21)6-14(22)9-30)27-20(26-18)31-10-15(23)7-16(24)11-31/h2-5,13-16,28H,6-11,21-24H2,1H3,(H,25,26,27,29) |
| InChIKey | GDWORWOXQJHQDR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|