About 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine
2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine (PubChem CID 21104307) has the molecular formula C12H7ClFIN2O
and a molecular weight of 376.56 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine |
| PubChem CID | 21104307 |
| Molecular Formula | C12H7ClFIN2O |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 375.93 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine |
| SMILES | Fc1ccc(Cl)cc1-c1nc(I)c2c(n1)COC2 |
| InChI | InChI=1S/C12H7ClFIN2O/c13-6-1-2-9(14)7(3-6)12-16-10-5-18-4-8(10)11(15)17-12/h1-3H,4-5H2 |
| InChIKey | DKKMOXNVPQTLHN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine?
The IUPAC name of 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine (CID 21104307) is 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine.
What is the SMILES notation for 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine?
The canonical SMILES for 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine is Fc1ccc(Cl)cc1-c1nc(I)c2c(n1)COC2.
What is the InChIKey of 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine?
The InChIKey is DKKMOXNVPQTLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClFIN2O/c13-6-1-2-9(14)7(3-6)12-16-10-5-18-4-8(10)11(15)17-12/h1-3H,4-5H2.
What are the key properties of 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine?
2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine has a molecular weight of 376.56 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2-fluorophenyl)-4-iodo-5,7-dihydrofuro[3,4-d]pyrimidine is sourced from PubChem (CID 21104307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).