About 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid
5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (PubChem CID 21104393) has the molecular formula C6H6F3N3O2
and a molecular weight of 209.13 g/mol. Its IUPAC name is 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| PubChem CID | 21104393 |
| Molecular Formula | C6H6F3N3O2 |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| SMILES | Nc1c(C(=O)O)cnn1CC(F)(F)F |
| InChI | InChI=1S/C6H6F3N3O2/c7-6(8,9)2-12-4(10)3(1-11-12)5(13)14/h1H,2,10H2,(H,13,14) |
| InChIKey | OUDJNFFYARIPEF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid?
The IUPAC name of 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (CID 21104393) is 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid is Nc1c(C(=O)O)cnn1CC(F)(F)F.
What is the InChIKey of 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid?
The InChIKey is OUDJNFFYARIPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F3N3O2/c7-6(8,9)2-12-4(10)3(1-11-12)5(13)14/h1H,2,10H2,(H,13,14).
What are the key properties of 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid?
5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid has a molecular weight of 209.13 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 21104393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).