About 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid
3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 21105741) has the molecular formula C16H10F3N3O3
and a molecular weight of 349.27 g/mol. Its IUPAC name is 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid |
| PubChem CID | 21105741 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1-c1nnc(-c2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C16H10F3N3O3/c17-16(18,19)10-4-1-8(2-5-10)13-21-22-14(25-13)11-6-3-9(15(23)24)7-12(11)20/h1-7H,20H2,(H,23,24) |
| InChIKey | PDSXZHRWJCCUME-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid?
The IUPAC name of 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid (CID 21105741) is 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid.
What is the SMILES notation for 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid?
The canonical SMILES for 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid is Nc1cc(C(=O)O)ccc1-c1nnc(-c2ccc(C(F)(F)F)cc2)o1.
What is the InChIKey of 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid?
The InChIKey is PDSXZHRWJCCUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N3O3/c17-16(18,19)10-4-1-8(2-5-10)13-21-22-14(25-13)11-6-3-9(15(23)24)7-12(11)20/h1-7H,20H2,(H,23,24).
What are the key properties of 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid?
3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid has a molecular weight of 349.27 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]benzoic acid is sourced from PubChem (CID 21105741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).