C10H20F5NO3S — CID 21105824
1,1,2,2,2-pentafluoroethanesulfonate;tetraethylazanium (PubChem CID 21105824) has the molecular formula C10H20F5NO3S and a molecular weight of 329.33 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethanesulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,2-pentafluoroethanesulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 21105824 |
| Molecular Formula | C10H20F5NO3S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethanesulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H20N.C2HF5O3S/c1-5-9(6-2,7-3)8-4;3-1(4,5)2(6,7)11(8,9)10/h5-8H2,1-4H3;(H,8,9,10)/q+1;/p-1 |
| InChIKey | HLJRVJPOBGUXOJ-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|