C10H22N2 — CID 21106193
azane;2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 21106193) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is azane;2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | azane;2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 21106193 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | azane;2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CC1CCC2CCCCC2N1.N |
| InChI | InChI=1S/C10H19N.H3N/c1-8-6-7-9-4-2-3-5-10(9)11-8;/h8-11H,2-7H2,1H3;1H3 |
| InChIKey | UPKDEGUTDFLVGE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |